C15H17NO3 — CID 72740960
4-benzyl-3-pent-2-enoyl-1,3-oxazolidin-2-one (PubChem CID 72740960) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-benzyl-3-pent-2-enoyl-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-pent-2-enoyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 72740960 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-benzyl-3-pent-2-enoyl-1,3-oxazolidin-2-one |
| SMILES | CCC=CC(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-2-3-9-14(17)16-13(11-19-15(16)18)10-12-7-5-4-6-8-12/h3-9,13H,2,10-11H2,1H3 |
| InChIKey | PPMFEJKQNMXSEY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|