C36H51NO7Si — CID 11296643
(E,2S,3R,4S,8S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8-trimethylnon-5-ene-1,7-dione (PubChem CID 11296643) has the molecular formula C36H51NO7Si and a molecular weight of 637.89 g/mol. Its IUPAC name is (E,2S,3R,4S,8S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8-trimethylnon-5-ene-1,7-dione.
| Compound Name | (E,2S,3R,4S,8S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8-trimethylnon-5-ene-1,7-dione |
|---|---|
| PubChem CID | 11296643 |
| Molecular Formula | C36H51NO7Si |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | (E,2S,3R,4S,8S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-2,4,8-trimethylnon-5-ene-1,7-dione |
| SMILES | COc1ccc(COC[C@H](C)C(=O)/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C36H51NO7Si/c1-25(15-20-32(38)26(2)22-42-23-29-16-18-31(41-7)19-17-29)33(44-45(8,9)36(4,5)6)27(3)34(39)37-30(24-43-35(37)40)21-28-13-11-10-12-14-28/h10-20,25-27,30,33H,21-24H2,1-9H3/b20-15+/t25-,26-,27-,30-,33+/m0/s1 |
| InChIKey | WEILBEZOMNVHNM-PULASOBISA-N |
| XLogP | 7.23 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|