C26H35NO4Si — CID 131746618
(4S)-4-benzyl-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 131746618) has the molecular formula C26H35NO4Si and a molecular weight of 453.66 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 131746618 |
| Molecular Formula | C26H35NO4Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (4S)-4-benzyl-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@](C)(CC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO4Si/c1-25(2,3)32(5,6)31-26(4,21-15-11-8-12-16-21)18-23(28)27-22(19-30-24(27)29)17-20-13-9-7-10-14-20/h7-16,22H,17-19H2,1-6H3/t22-,26-/m0/s1 |
| InChIKey | DJRUCAKWEWUQAZ-NVQXNPDNSA-N |
| XLogP | 5.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|