C34H52F3NO7SSi2 — CID 174060062
(4R)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one;[tert-butyl(dimethyl)silyl] trifluoromethanesulfonate (PubChem CID 174060062) has the molecular formula C34H52F3NO7SSi2 and a molecular weight of 732.02 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one;[tert-butyl(dimethyl)silyl] trifluoromethanesulfonate.
| Compound Name | (4R)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one;[tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174060062 |
| Molecular Formula | C34H52F3NO7SSi2 |
| Molecular Weight | 732.02 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | (4R)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylbutanoyl]-1,3-oxazolidin-2-one;[tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| SMILES | CC(C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)C(C)(O[Si](C)(C)C(C)(C)C)c1ccccc1.CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C27H37NO4Si.C7H15F3O3SSi/c1-20(24(29)28-23(19-31-25(28)30)18-21-14-10-8-11-15-21)27(5,22-16-12-9-13-17-22)32-33(6,7)26(2,3)4;1-6(2,3)15(4,5)13-14(11,12)7(8,9)10/h8-17,20,23H,18-19H2,1-7H3;1-5H3/t20?,23-,27?;/m1./s1 |
| InChIKey | PWIGCWOJNYMCIH-MIRTUEKHSA-N |
| XLogP | 9.01 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.02 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|