C17H26O2Si — CID 46899660
[(1Z)-3,3-dimethyl-1-phenylmethoxypenta-1,4-dien-2-yl]oxy-trimethylsilane (PubChem CID 46899660) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is [(1Z)-3,3-dimethyl-1-phenylmethoxypenta-1,4-dien-2-yl]oxy-trimethylsilane.
| Compound Name | [(1Z)-3,3-dimethyl-1-phenylmethoxypenta-1,4-dien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 46899660 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [(1Z)-3,3-dimethyl-1-phenylmethoxypenta-1,4-dien-2-yl]oxy-trimethylsilane |
| SMILES | C=CC(C)(C)/C(=C/OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C17H26O2Si/c1-7-17(2,3)16(19-20(4,5)6)14-18-13-15-11-9-8-10-12-15/h7-12,14H,1,13H2,2-6H3/b16-14- |
| InChIKey | REPKZMBOLNSGGQ-PEZBUJJGSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|