C18H27F3O2Si2 — CID 177391977
trimethyl-[(2E,4Z)-1,1,1-trifluoro-6-phenyl-4-trimethylsilyloxyhexa-2,4-dien-2-yl]oxysilane (PubChem CID 177391977) has the molecular formula C18H27F3O2Si2 and a molecular weight of 388.58 g/mol. Its IUPAC name is trimethyl-[(2E,4Z)-1,1,1-trifluoro-6-phenyl-4-trimethylsilyloxyhexa-2,4-dien-2-yl]oxysilane.
| Compound Name | trimethyl-[(2E,4Z)-1,1,1-trifluoro-6-phenyl-4-trimethylsilyloxyhexa-2,4-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 177391977 |
| Molecular Formula | C18H27F3O2Si2 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | trimethyl-[(2E,4Z)-1,1,1-trifluoro-6-phenyl-4-trimethylsilyloxyhexa-2,4-dien-2-yl]oxysilane |
| SMILES | C[Si](C)(C)OC(=C\Cc1ccccc1)/C=C(/O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H27F3O2Si2/c1-24(2,3)22-16(13-12-15-10-8-7-9-11-15)14-17(18(19,20)21)23-25(4,5)6/h7-11,13-14H,12H2,1-6H3/b16-13-,17-14+ |
| InChIKey | GCYBLRJHVMGVOO-FEUFJANWSA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|