C30H26 — CID 73056693
1-phenyl-4-[(2E,4E)-4-(4-phenylphenyl)hexa-2,4-dien-3-yl]benzene (PubChem CID 73056693) has the molecular formula C30H26 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-phenyl-4-[(2E,4E)-4-(4-phenylphenyl)hexa-2,4-dien-3-yl]benzene.
| Compound Name | 1-phenyl-4-[(2E,4E)-4-(4-phenylphenyl)hexa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 73056693 |
| Molecular Formula | C30H26 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-phenyl-4-[(2E,4E)-4-(4-phenylphenyl)hexa-2,4-dien-3-yl]benzene |
| SMILES | C/C=C(C(=C/C)/c1ccc(-c2ccccc2)cc1)\c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26/c1-3-29(27-19-15-25(16-20-27)23-11-7-5-8-12-23)30(4-2)28-21-17-26(18-22-28)24-13-9-6-10-14-24/h3-22H,1-2H3/b29-3+,30-4+ |
| InChIKey | ILTZAJQWAFJTMT-PSWLKOFHSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|