C21H30 — CID 145283971
ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;(2Z,4Z)-hexa-2,4-diene (PubChem CID 145283971) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 145283971 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.C=C/C=C(\C=C)Cc1ccccc1.CC |
| InChI | InChI=1S/C13H14.C6H10.C2H6/c1-3-8-12(4-2)11-13-9-6-5-7-10-13;1-3-5-6-4-2;1-2/h3-10H,1-2,11H2;3-6H,1-2H3;1-2H3/b12-8+;5-3-,6-4-; |
| InChIKey | RIZMOHXAYXVQEW-RQZOFLDTSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|