C13H14O — CID 144855364
(3Z)-4-benzylhexa-1,3,5-trien-2-ol (PubChem CID 144855364) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (3Z)-4-benzylhexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-4-benzylhexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 144855364 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (3Z)-4-benzylhexa-1,3,5-trien-2-ol |
| SMILES | C=C/C(=C\C(=C)O)Cc1ccccc1 |
| InChI | InChI=1S/C13H14O/c1-3-12(9-11(2)14)10-13-7-5-4-6-8-13/h3-9,14H,1-2,10H2/b12-9+ |
| InChIKey | ZVOHARDGGHIUSP-FMIVXFBMSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|