C15H18 — CID 143856849
[(3Z)-4,5-dimethyl-2-methylidenehexa-3,5-dienyl]benzene (PubChem CID 143856849) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is [(3Z)-4,5-dimethyl-2-methylidenehexa-3,5-dienyl]benzene.
| Compound Name | [(3Z)-4,5-dimethyl-2-methylidenehexa-3,5-dienyl]benzene |
|---|---|
| PubChem CID | 143856849 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(3Z)-4,5-dimethyl-2-methylidenehexa-3,5-dienyl]benzene |
| SMILES | C=C(/C=C(/C)C(=C)C)Cc1ccccc1 |
| InChI | InChI=1S/C15H18/c1-12(2)14(4)10-13(3)11-15-8-6-5-7-9-15/h5-10H,1,3,11H2,2,4H3/b14-10- |
| InChIKey | WWEAJULMOQHZCZ-UVTDQMKNSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|