C12H12O — CID 146162292
(2E)-4-benzylpenta-2,4-dienal (PubChem CID 146162292) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (2E)-4-benzylpenta-2,4-dienal.
| Compound Name | (2E)-4-benzylpenta-2,4-dienal |
|---|---|
| PubChem CID | 146162292 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (2E)-4-benzylpenta-2,4-dienal |
| SMILES | C=C(/C=C/C=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-11(6-5-9-13)10-12-7-3-2-4-8-12/h2-9H,1,10H2/b6-5+ |
| InChIKey | UMWKQRQCWSKACQ-AATRIKPKSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|