C13H15NO — CID 135192037
(2E)-4-benzyl-2-methylpenta-2,4-dienamide (PubChem CID 135192037) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2E)-4-benzyl-2-methylpenta-2,4-dienamide.
| Compound Name | (2E)-4-benzyl-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 135192037 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2E)-4-benzyl-2-methylpenta-2,4-dienamide |
| SMILES | C=C(/C=C(\C)C(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-10(8-11(2)13(14)15)9-12-6-4-3-5-7-12/h3-8H,1,9H2,2H3,(H2,14,15)/b11-8+ |
| InChIKey | BOAZFZDYFOLGDC-DHZHZOJOSA-N |
| XLogP | 2.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|