C11H10O — CID 142401977
3-benzylbuta-1,3-dien-1-one (PubChem CID 142401977) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-benzylbuta-1,3-dien-1-one.
| Compound Name | 3-benzylbuta-1,3-dien-1-one |
|---|---|
| PubChem CID | 142401977 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-benzylbuta-1,3-dien-1-one |
| SMILES | C=C(C=C=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H10O/c1-10(7-8-12)9-11-5-3-2-4-6-11/h2-7H,1,9H2 |
| InChIKey | POGNQJYTSNHPGW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|