C18H18O — CID 12877597
(E)-4-methyl-1,5-diphenylpent-3-en-2-one (PubChem CID 12877597) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (E)-4-methyl-1,5-diphenylpent-3-en-2-one.
| Compound Name | (E)-4-methyl-1,5-diphenylpent-3-en-2-one |
|---|---|
| PubChem CID | 12877597 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E)-4-methyl-1,5-diphenylpent-3-en-2-one |
| SMILES | C/C(=C\C(=O)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-15(12-16-8-4-2-5-9-16)13-18(19)14-17-10-6-3-7-11-17/h2-11,13H,12,14H2,1H3/b15-13+ |
| InChIKey | MPGVAKQVHLDWKI-FYWRMAATSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|