C40H34O2 — CID 155301097
(E)-4-[4-[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]phenyl]-1,5-diphenylpent-3-en-2-one (PubChem CID 155301097) has the molecular formula C40H34O2 and a molecular weight of 546.71 g/mol. Its IUPAC name is (E)-4-[4-[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]phenyl]-1,5-diphenylpent-3-en-2-one.
| Compound Name | (E)-4-[4-[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]phenyl]-1,5-diphenylpent-3-en-2-one |
|---|---|
| PubChem CID | 155301097 |
| Molecular Formula | C40H34O2 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (E)-4-[4-[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]phenyl]-1,5-diphenylpent-3-en-2-one |
| SMILES | O=C(/C=C(\Cc1ccccc1)c1ccc(/C(=C/C(=O)Cc2ccccc2)Cc2ccccc2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C40H34O2/c41-39(27-33-17-9-3-10-18-33)29-37(25-31-13-5-1-6-14-31)35-21-23-36(24-22-35)38(26-32-15-7-2-8-16-32)30-40(42)28-34-19-11-4-12-20-34/h1-24,29-30H,25-28H2/b37-29+,38-30+ |
| InChIKey | XNKQJZLBXJGROF-UDEUAJILSA-N |
| XLogP | 8.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|