About erbium;(2-phenylacetyl)azanide
erbium;(2-phenylacetyl)azanide (PubChem CID 87733239) has the molecular formula C8H8ErNO-
and a molecular weight of 301.42 g/mol. Its IUPAC name is erbium;(2-phenylacetyl)azanide.
Molecular Properties
| Compound Name | erbium;(2-phenylacetyl)azanide |
| PubChem CID | 87733239 |
| Molecular Formula | C8H8ErNO- |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | erbium;(2-phenylacetyl)azanide |
| SMILES | [Er].[NH-]C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C8H9NO.Er/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H2,9,10);/p-1 |
| InChIKey | WGOHISZWTGGMGL-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze erbium;(2-phenylacetyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of erbium;(2-phenylacetyl)azanide?
The IUPAC name of erbium;(2-phenylacetyl)azanide (CID 87733239) is erbium;(2-phenylacetyl)azanide.
What is the SMILES notation for erbium;(2-phenylacetyl)azanide?
The canonical SMILES for erbium;(2-phenylacetyl)azanide is [Er].[NH-]C(=O)Cc1ccccc1.
What is the InChIKey of erbium;(2-phenylacetyl)azanide?
The InChIKey is WGOHISZWTGGMGL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO.Er/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H2,9,10);/p-1.
What are the key properties of erbium;(2-phenylacetyl)azanide?
erbium;(2-phenylacetyl)azanide has a molecular weight of 301.42 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for erbium;(2-phenylacetyl)azanide is sourced from PubChem (CID 87733239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).