About 2-phenylethanethioate;rubidium(1+)
2-phenylethanethioate;rubidium(1+) (PubChem CID 177366223) has the molecular formula C8H7ORbS
and a molecular weight of 236.68 g/mol. Its IUPAC name is 2-phenylethanethioate;rubidium(1+).
Molecular Properties
| Compound Name | 2-phenylethanethioate;rubidium(1+) |
| PubChem CID | 177366223 |
| Molecular Formula | C8H7ORbS |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 2-phenylethanethioate;rubidium(1+) |
| SMILES | O=C([S-])Cc1ccccc1.[Rb+] |
| InChI | InChI=1S/C8H8OS.Rb/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | ZBMZLOKTSNQKJL-UHFFFAOYSA-M |
| XLogP | -1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethanethioate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethanethioate;rubidium(1+)?
The IUPAC name of 2-phenylethanethioate;rubidium(1+) (CID 177366223) is 2-phenylethanethioate;rubidium(1+).
What is the SMILES notation for 2-phenylethanethioate;rubidium(1+)?
The canonical SMILES for 2-phenylethanethioate;rubidium(1+) is O=C([S-])Cc1ccccc1.[Rb+].
What is the InChIKey of 2-phenylethanethioate;rubidium(1+)?
The InChIKey is ZBMZLOKTSNQKJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8OS.Rb/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1.
What are the key properties of 2-phenylethanethioate;rubidium(1+)?
2-phenylethanethioate;rubidium(1+) has a molecular weight of 236.68 g/mol, XLogP of -1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethanethioate;rubidium(1+) is sourced from PubChem (CID 177366223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).