C36H36N2O2 — CID 177397083
(Z)-4-[2-[[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]amino]ethylamino]-1,5-diphenylpent-3-en-2-one (PubChem CID 177397083) has the molecular formula C36H36N2O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is (Z)-4-[2-[[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]amino]ethylamino]-1,5-diphenylpent-3-en-2-one.
| Compound Name | (Z)-4-[2-[[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]amino]ethylamino]-1,5-diphenylpent-3-en-2-one |
|---|---|
| PubChem CID | 177397083 |
| Molecular Formula | C36H36N2O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | (Z)-4-[2-[[(E)-4-oxo-1,5-diphenylpent-2-en-2-yl]amino]ethylamino]-1,5-diphenylpent-3-en-2-one |
| SMILES | O=C(/C=C(/Cc1ccccc1)NCCN/C(=C/C(=O)Cc1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H36N2O2/c39-35(25-31-17-9-3-10-18-31)27-33(23-29-13-5-1-6-14-29)37-21-22-38-34(24-30-15-7-2-8-16-30)28-36(40)26-32-19-11-4-12-20-32/h1-20,27-28,37-38H,21-26H2/b33-27-,34-28+ |
| InChIKey | AZYSHYUKJRWQOC-DENOHBPFSA-N |
| XLogP | 6.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|