C19H21NO — CID 11414802
(E)-1,4-diphenyl-3-(propylamino)but-2-en-1-one (PubChem CID 11414802) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (E)-1,4-diphenyl-3-(propylamino)but-2-en-1-one.
| Compound Name | (E)-1,4-diphenyl-3-(propylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 11414802 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (E)-1,4-diphenyl-3-(propylamino)but-2-en-1-one |
| SMILES | CCCN/C(=C/C(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-2-13-20-18(14-16-9-5-3-6-10-16)15-19(21)17-11-7-4-8-12-17/h3-12,15,20H,2,13-14H2,1H3/b18-15+ |
| InChIKey | CJVRPQSCAXYDQE-OBGWFSINSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|