C23H21NO — CID 4311429
3-(4-methylanilino)-1,4-diphenylbut-2-en-1-one (PubChem CID 4311429) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-(4-methylanilino)-1,4-diphenylbut-2-en-1-one.
| Compound Name | 3-(4-methylanilino)-1,4-diphenylbut-2-en-1-one |
|---|---|
| PubChem CID | 4311429 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(4-methylanilino)-1,4-diphenylbut-2-en-1-one |
| SMILES | Cc1ccc(NC(=CC(=O)c2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-18-12-14-21(15-13-18)24-22(16-19-8-4-2-5-9-19)17-23(25)20-10-6-3-7-11-20/h2-15,17,24H,16H2,1H3 |
| InChIKey | NIYXZRGCFRSLLX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|