C33H33NO3 — CID 14916540
(Z)-4-(4-methylanilino)-5-[4-methyl-2,5-bis(phenylmethoxy)phenyl]pent-3-en-2-one (PubChem CID 14916540) has the molecular formula C33H33NO3 and a molecular weight of 491.63 g/mol. Its IUPAC name is (Z)-4-(4-methylanilino)-5-[4-methyl-2,5-bis(phenylmethoxy)phenyl]pent-3-en-2-one.
| Compound Name | (Z)-4-(4-methylanilino)-5-[4-methyl-2,5-bis(phenylmethoxy)phenyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 14916540 |
| Molecular Formula | C33H33NO3 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (Z)-4-(4-methylanilino)-5-[4-methyl-2,5-bis(phenylmethoxy)phenyl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C(/Cc1cc(OCc2ccccc2)c(C)cc1OCc1ccccc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C33H33NO3/c1-24-14-16-30(17-15-24)34-31(19-26(3)35)20-29-21-32(36-22-27-10-6-4-7-11-27)25(2)18-33(29)37-23-28-12-8-5-9-13-28/h4-19,21,34H,20,22-23H2,1-3H3/b31-19- |
| InChIKey | BPBFAXXDKZZSLH-DXJNIWACSA-N |
| XLogP | 7.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|