C21H28N2O — CID 142417856
(2E,4E)-4-benzyl-5-methyl-2-[(1E)-2-methyl-3-(methylamino)buta-1,3-dienyl]hepta-2,4-dienamide (PubChem CID 142417856) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (2E,4E)-4-benzyl-5-methyl-2-[(1E)-2-methyl-3-(methylamino)buta-1,3-dienyl]hepta-2,4-dienamide.
| Compound Name | (2E,4E)-4-benzyl-5-methyl-2-[(1E)-2-methyl-3-(methylamino)buta-1,3-dienyl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 142417856 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (2E,4E)-4-benzyl-5-methyl-2-[(1E)-2-methyl-3-(methylamino)buta-1,3-dienyl]hepta-2,4-dienamide |
| SMILES | C=C(NC)/C(C)=C/C(=C\C(Cc1ccccc1)=C(/C)CC)C(N)=O |
| InChI | InChI=1S/C21H28N2O/c1-6-15(2)19(13-18-10-8-7-9-11-18)14-20(21(22)24)12-16(3)17(4)23-5/h7-12,14,23H,4,6,13H2,1-3,5H3,(H2,22,24)/b16-12+,19-15+,20-14+ |
| InChIKey | SBUOISQRTKDFRY-KALZTQBLSA-N |
| XLogP | 4.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|