C25H39N3O — CID 142417886
N-(3-aminopropyl)formamide;(3E,5Z)-7-benzyl-N,3,5,8-tetramethyldeca-1,3,5,7-tetraen-2-amine (PubChem CID 142417886) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is N-(3-aminopropyl)formamide;(3E,5Z)-7-benzyl-N,3,5,8-tetramethyldeca-1,3,5,7-tetraen-2-amine.
| Compound Name | N-(3-aminopropyl)formamide;(3E,5Z)-7-benzyl-N,3,5,8-tetramethyldeca-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 142417886 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | N-(3-aminopropyl)formamide;(3E,5Z)-7-benzyl-N,3,5,8-tetramethyldeca-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(NC)/C(C)=C/C(C)=C\C(Cc1ccccc1)=C(C)CC.NCCCNC=O |
| InChI | InChI=1S/C21H29N.C4H10N2O/c1-7-17(3)21(15-20-11-9-8-10-12-20)14-16(2)13-18(4)19(5)22-6;5-2-1-3-6-4-7/h8-14,22H,5,7,15H2,1-4,6H3;4H,1-3,5H2,(H,6,7)/b16-14-,18-13+,21-17?; |
| InChIKey | XEQHCRZTMIXDSY-DUYHKXASSA-N |
| XLogP | 4.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|