C20H29N3O4 — CID 168936328
2-methylprop-2-enyl N-[1-(5-formamidopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 168936328) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-methylprop-2-enyl N-[1-(5-formamidopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | 2-methylprop-2-enyl N-[1-(5-formamidopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 168936328 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-methylprop-2-enyl N-[1-(5-formamidopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C=C(C)COC(=O)NC(Cc1ccccc1)C(=O)NCCCCCNC=O |
| InChI | InChI=1S/C20H29N3O4/c1-16(2)14-27-20(26)23-18(13-17-9-5-3-6-10-17)19(25)22-12-8-4-7-11-21-15-24/h3,5-6,9-10,15,18H,1,4,7-8,11-14H2,2H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | RTBQNIXVKKJOBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|