C20H38N4O — CID 177368272
N,N'-bis(3-aminopropyl)butane-1,4-diamine;1-(2-ethylphenyl)ethanone (PubChem CID 177368272) has the molecular formula C20H38N4O and a molecular weight of 350.55 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)butane-1,4-diamine;1-(2-ethylphenyl)ethanone.
| Compound Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;1-(2-ethylphenyl)ethanone |
|---|---|
| PubChem CID | 177368272 |
| Molecular Formula | C20H38N4O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;1-(2-ethylphenyl)ethanone |
| SMILES | CCc1ccccc1C(C)=O.NCCCNCCCCNCCCN |
| InChI | InChI=1S/C10H26N4.C10H12O/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;1-3-9-6-4-5-7-10(9)8(2)11/h13-14H,1-12H2;4-7H,3H2,1-2H3 |
| InChIKey | VZALZKOPTOFUBT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|