About 1-phenylpropane-2-thione
1-phenylpropane-2-thione (PubChem CID 19915653) has the molecular formula C9H10S
and a molecular weight of 150.25 g/mol. Its IUPAC name is 1-phenylpropane-2-thione.
Molecular Properties
| Compound Name | 1-phenylpropane-2-thione |
| PubChem CID | 19915653 |
| Molecular Formula | C9H10S |
| Molecular Weight | 150.25 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 1-phenylpropane-2-thione |
| SMILES | CC(=S)Cc1ccccc1 |
| InChI | InChI=1S/C9H10S/c1-8(10)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | VWRNGTRNWYKKJE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropane-2-thione?
The IUPAC name of 1-phenylpropane-2-thione (CID 19915653) is 1-phenylpropane-2-thione.
What is the SMILES notation for 1-phenylpropane-2-thione?
The canonical SMILES for 1-phenylpropane-2-thione is CC(=S)Cc1ccccc1.
What is the InChIKey of 1-phenylpropane-2-thione?
The InChIKey is VWRNGTRNWYKKJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S/c1-8(10)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of 1-phenylpropane-2-thione?
1-phenylpropane-2-thione has a molecular weight of 150.25 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropane-2-thione is sourced from PubChem (CID 19915653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).