C12H16N2O2 — CID 15121331
N'-acetyl-N,N'-dimethyl-2-phenylacetohydrazide (PubChem CID 15121331) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N'-acetyl-N,N'-dimethyl-2-phenylacetohydrazide.
| Compound Name | N'-acetyl-N,N'-dimethyl-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 15121331 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-acetyl-N,N'-dimethyl-2-phenylacetohydrazide |
| SMILES | CC(=O)N(C)N(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c1-10(15)13(2)14(3)12(16)9-11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 |
| InChIKey | USMZCXRPQOOEQC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|