C13H17NO3 — CID 62818448
2-methyl-2-[methyl-(2-phenylacetyl)amino]propanoic acid (PubChem CID 62818448) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-methyl-2-[methyl-(2-phenylacetyl)amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl-(2-phenylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62818448 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-methyl-2-[methyl-(2-phenylacetyl)amino]propanoic acid |
| SMILES | CN(C(=O)Cc1ccccc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H17NO3/c1-13(2,12(16)17)14(3)11(15)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,16,17) |
| InChIKey | DSSCXILEWKGTAI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |