C13H14O4 — CID 11948255
2-methyl-2-(3-phenylprop-1-en-2-yl)propanedioic acid (PubChem CID 11948255) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-methyl-2-(3-phenylprop-1-en-2-yl)propanedioic acid.
| Compound Name | 2-methyl-2-(3-phenylprop-1-en-2-yl)propanedioic acid |
|---|---|
| PubChem CID | 11948255 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-methyl-2-(3-phenylprop-1-en-2-yl)propanedioic acid |
| SMILES | C=C(Cc1ccccc1)C(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H14O4/c1-9(8-10-6-4-3-5-7-10)13(2,11(14)15)12(16)17/h3-7H,1,8H2,2H3,(H,14,15)(H,16,17) |
| InChIKey | SCNIYJNLVYKBCK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|