C13H14O5 — CID 90238430
2-(2-benzylprop-2-enoyloxy)-2-hydroxypropanoic acid (PubChem CID 90238430) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-(2-benzylprop-2-enoyloxy)-2-hydroxypropanoic acid.
| Compound Name | 2-(2-benzylprop-2-enoyloxy)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 90238430 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-(2-benzylprop-2-enoyloxy)-2-hydroxypropanoic acid |
| SMILES | C=C(Cc1ccccc1)C(=O)OC(C)(O)C(=O)O |
| InChI | InChI=1S/C13H14O5/c1-9(8-10-6-4-3-5-7-10)11(14)18-13(2,17)12(15)16/h3-7,17H,1,8H2,2H3,(H,15,16) |
| InChIKey | DQBMRYCEQGASQH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|