C19H26O4 — CID 174894850
but-2-ene;methyl 2-benzylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174894850) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is but-2-ene;methyl 2-benzylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | but-2-ene;methyl 2-benzylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174894850 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | but-2-ene;methyl 2-benzylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(Cc1ccccc1)C(=O)OC.CC=CC |
| InChI | InChI=1S/C11H12O2.C4H6O2.C4H8/c1-9(11(12)13-2)8-10-6-4-3-5-7-10;1-3(2)4(5)6;1-3-4-2/h3-7H,1,8H2,2H3;1H2,2H3,(H,5,6);3-4H,1-2H3 |
| InChIKey | AXRRCFUJQCXGOP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|