C19H26O4 — CID 174801501
methyl 2-benzylprop-2-enoate;methyl 3,3-dimethyl-2-methylidenebutanoate (PubChem CID 174801501) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 2-benzylprop-2-enoate;methyl 3,3-dimethyl-2-methylidenebutanoate.
| Compound Name | methyl 2-benzylprop-2-enoate;methyl 3,3-dimethyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 174801501 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 2-benzylprop-2-enoate;methyl 3,3-dimethyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)C(C)(C)C.C=C(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C11H12O2.C8H14O2/c1-9(11(12)13-2)8-10-6-4-3-5-7-10;1-6(7(9)10-5)8(2,3)4/h3-7H,1,8H2,2H3;1H2,2-5H3 |
| InChIKey | QRHUIJIPPGVCSE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|