About methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate
methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate (PubChem CID 44721250) has the molecular formula C28H25O2P
and a molecular weight of 424.48 g/mol. Its IUPAC name is methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate.
Molecular Properties
| Compound Name | methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate |
| PubChem CID | 44721250 |
| Molecular Formula | C28H25O2P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25O2P/c1-30-28(29)27(22-23-14-6-2-7-15-23)31(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,22H2,1H3 |
| InChIKey | YVRCHXOPKRUNCK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate?
The IUPAC name of methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate (CID 44721250) is methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate.
What is the SMILES notation for methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate?
The canonical SMILES for methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate is COC(=O)C(Cc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate?
The InChIKey is YVRCHXOPKRUNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25O2P/c1-30-28(29)27(22-23-14-6-2-7-15-23)31(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,22H2,1H3.
What are the key properties of methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate?
methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate has a molecular weight of 424.48 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-phenyl-2-(triphenyl-λ5-phosphanylidene)propanoate is sourced from PubChem (CID 44721250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).