About dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate
dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate (PubChem CID 139060105) has the molecular formula C46H42O8P2
and a molecular weight of 784.78 g/mol. Its IUPAC name is dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate |
| PubChem CID | 139060105 |
| Molecular Formula | C46H42O8P2 |
| Molecular Weight | 784.78 g/mol |
| Exact Mass | 784.24 |
| IUPAC Name | dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1.COC(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C23H21O4P/c2*1-26-22(24)21(23(25)27-2)28(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h2*3-17H,1-2H3 |
| InChIKey | RDMXZFZBAKVSDJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 784.78 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate?
The IUPAC name of dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate (CID 139060105) is dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate.
What is the SMILES notation for dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate?
The canonical SMILES for dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate is COC(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1.COC(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate?
The InChIKey is RDMXZFZBAKVSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C23H21O4P/c2*1-26-22(24)21(23(25)27-2)28(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h2*3-17H,1-2H3.
What are the key properties of dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate?
dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate has a molecular weight of 784.78 g/mol, XLogP of 5.00, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(triphenyl-λ5-phosphanylidene)propanedioate is sourced from PubChem (CID 139060105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).