C29H33NO7P2 — CID 23229056
dimethyl (2E)-2-(diethoxyphosphorylmethylimino)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 23229056) has the molecular formula C29H33NO7P2 and a molecular weight of 569.53 g/mol. Its IUPAC name is dimethyl (2E)-2-(diethoxyphosphorylmethylimino)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | dimethyl (2E)-2-(diethoxyphosphorylmethylimino)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 23229056 |
| Molecular Formula | C29H33NO7P2 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | dimethyl (2E)-2-(diethoxyphosphorylmethylimino)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CCOP(=O)(C/N=C(\C(=O)OC)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C29H33NO7P2/c1-5-36-38(33,37-6-2)22-30-26(28(31)34-3)27(29(32)35-4)39(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21H,5-6,22H2,1-4H3/b30-26- |
| InChIKey | FOKGOQPPWXIGLE-BXVZCJGGSA-N |
| XLogP | 4.16 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|