C23H23O2P — CID 12696810
methyl 2-(triphenyl-λ5-phosphanylidene)butanoate (PubChem CID 12696810) has the molecular formula C23H23O2P and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-(triphenyl-λ5-phosphanylidene)butanoate.
| Compound Name | methyl 2-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 12696810 |
| Molecular Formula | C23H23O2P |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl 2-(triphenyl-λ5-phosphanylidene)butanoate |
| SMILES | CCC(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23O2P/c1-3-22(23(24)25-2)26(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,3H2,1-2H3 |
| InChIKey | PTEZLIBVFKEZCS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|