C23H20F3OP — CID 15014407
1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)pentan-2-one (PubChem CID 15014407) has the molecular formula C23H20F3OP and a molecular weight of 400.38 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)pentan-2-one.
| Compound Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)pentan-2-one |
|---|---|
| PubChem CID | 15014407 |
| Molecular Formula | C23H20F3OP |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)pentan-2-one |
| SMILES | CCC(C(=O)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20F3OP/c1-2-21(22(27)23(24,25)26)28(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,2H2,1H3 |
| InChIKey | GKIFHSZUTMGACK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|