About 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid
3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid (PubChem CID 122517879) has the molecular formula C22H18NO2P
and a molecular weight of 359.37 g/mol. Its IUPAC name is 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid.
Molecular Properties
| Compound Name | 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid |
| PubChem CID | 122517879 |
| Molecular Formula | C22H18NO2P |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid |
| SMILES | N#CCC(C(=O)O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18NO2P/c23-17-16-21(22(24)25)26(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16H2,(H,24,25) |
| InChIKey | MSVLUGIFAOIHPE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The IUPAC name of 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid (CID 122517879) is 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid.
What is the SMILES notation for 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The canonical SMILES for 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid is N#CCC(C(=O)O)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The InChIKey is MSVLUGIFAOIHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18NO2P/c23-17-16-21(22(24)25)26(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16H2,(H,24,25).
What are the key properties of 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid?
3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid has a molecular weight of 359.37 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-2-(triphenyl-λ5-phosphanylidene)propanoic acid is sourced from PubChem (CID 122517879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).