C43H32N2O2P2 — CID 101017061
3,5-dioxo-2,6-bis(triphenyl-λ5-phosphanylidene)heptanedinitrile (PubChem CID 101017061) has the molecular formula C43H32N2O2P2 and a molecular weight of 670.69 g/mol. Its IUPAC name is 3,5-dioxo-2,6-bis(triphenyl-λ5-phosphanylidene)heptanedinitrile.
| Compound Name | 3,5-dioxo-2,6-bis(triphenyl-λ5-phosphanylidene)heptanedinitrile |
|---|---|
| PubChem CID | 101017061 |
| Molecular Formula | C43H32N2O2P2 |
| Molecular Weight | 670.69 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | 3,5-dioxo-2,6-bis(triphenyl-λ5-phosphanylidene)heptanedinitrile |
| SMILES | N#CC(C(=O)CC(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H32N2O2P2/c44-32-42(48(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36)40(46)31-41(47)43(33-45)49(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-30H,31H2 |
| InChIKey | MYDBYHSRKMQHFK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|