About 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile
4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile (PubChem CID 159827333) has the molecular formula C23H20NOP
and a molecular weight of 357.39 g/mol. Its IUPAC name is 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile.
Molecular Properties
| Compound Name | 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile |
| PubChem CID | 159827333 |
| Molecular Formula | C23H20NOP |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile |
| SMILES | CC(=O)C(CC#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20NOP/c1-19(25)23(17-18-24)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16H,17H2,1H3 |
| InChIKey | AFIMVNGKVNBYLC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile?
The IUPAC name of 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile (CID 159827333) is 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile.
What is the SMILES notation for 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile?
The canonical SMILES for 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile is CC(=O)C(CC#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile?
The InChIKey is AFIMVNGKVNBYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20NOP/c1-19(25)23(17-18-24)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16H,17H2,1H3.
What are the key properties of 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile?
4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile has a molecular weight of 357.39 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3-(triphenyl-λ5-phosphanylidene)pentanenitrile is sourced from PubChem (CID 159827333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).