C28H23O2P — CID 134924093
1-phenyl-1-(triphenyl-λ5-phosphanylidene)butane-2,3-dione (PubChem CID 134924093) has the molecular formula C28H23O2P and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-phenyl-1-(triphenyl-λ5-phosphanylidene)butane-2,3-dione.
| Compound Name | 1-phenyl-1-(triphenyl-λ5-phosphanylidene)butane-2,3-dione |
|---|---|
| PubChem CID | 134924093 |
| Molecular Formula | C28H23O2P |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-phenyl-1-(triphenyl-λ5-phosphanylidene)butane-2,3-dione |
| SMILES | CC(=O)C(=O)C(c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23O2P/c1-22(29)27(30)28(23-14-6-2-7-15-23)31(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,1H3 |
| InChIKey | AXWKRTFJXYAIAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|