About 2-(triphenyl-λ5-phosphanylidene)propanoic acid
2-(triphenyl-λ5-phosphanylidene)propanoic acid (PubChem CID 13030225) has the molecular formula C21H19O2P
and a molecular weight of 334.36 g/mol. Its IUPAC name is 2-(triphenyl-λ5-phosphanylidene)propanoic acid.
Molecular Properties
| Compound Name | 2-(triphenyl-λ5-phosphanylidene)propanoic acid |
| PubChem CID | 13030225 |
| Molecular Formula | C21H19O2P |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(triphenyl-λ5-phosphanylidene)propanoic acid |
| SMILES | CC(C(=O)O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19O2P/c1-17(21(22)23)24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3,(H,22,23) |
| InChIKey | IMXWOEKQTUITPO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(triphenyl-λ5-phosphanylidene)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The IUPAC name of 2-(triphenyl-λ5-phosphanylidene)propanoic acid (CID 13030225) is 2-(triphenyl-λ5-phosphanylidene)propanoic acid.
What is the SMILES notation for 2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The canonical SMILES for 2-(triphenyl-λ5-phosphanylidene)propanoic acid is CC(C(=O)O)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(triphenyl-λ5-phosphanylidene)propanoic acid?
The InChIKey is IMXWOEKQTUITPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O2P/c1-17(21(22)23)24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3,(H,22,23).
What are the key properties of 2-(triphenyl-λ5-phosphanylidene)propanoic acid?
2-(triphenyl-λ5-phosphanylidene)propanoic acid has a molecular weight of 334.36 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triphenyl-λ5-phosphanylidene)propanoic acid is sourced from PubChem (CID 13030225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).