C35H29OP — CID 11755568
(E)-3-methyl-1,4-diphenyl-1-(triphenyl-λ5-phosphanylidene)but-3-en-2-one (PubChem CID 11755568) has the molecular formula C35H29OP and a molecular weight of 496.59 g/mol. Its IUPAC name is (E)-3-methyl-1,4-diphenyl-1-(triphenyl-λ5-phosphanylidene)but-3-en-2-one.
| Compound Name | (E)-3-methyl-1,4-diphenyl-1-(triphenyl-λ5-phosphanylidene)but-3-en-2-one |
|---|---|
| PubChem CID | 11755568 |
| Molecular Formula | C35H29OP |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (E)-3-methyl-1,4-diphenyl-1-(triphenyl-λ5-phosphanylidene)but-3-en-2-one |
| SMILES | C/C(=C\c1ccccc1)C(=O)C(c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H29OP/c1-28(27-29-17-7-2-8-18-29)34(36)35(30-19-9-3-10-20-30)37(31-21-11-4-12-22-31,32-23-13-5-14-24-32)33-25-15-6-16-26-33/h2-27H,1H3/b28-27+ |
| InChIKey | CMUVJMSNZBDQIA-BYYHNAKLSA-N |
| XLogP | 6.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|