C19H18O2 — CID 101412712
(E)-2-methyl-1,6-diphenylhex-1-ene-3,4-dione (PubChem CID 101412712) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (E)-2-methyl-1,6-diphenylhex-1-ene-3,4-dione.
| Compound Name | (E)-2-methyl-1,6-diphenylhex-1-ene-3,4-dione |
|---|---|
| PubChem CID | 101412712 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E)-2-methyl-1,6-diphenylhex-1-ene-3,4-dione |
| SMILES | C/C(=C\c1ccccc1)C(=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H18O2/c1-15(14-17-10-6-3-7-11-17)19(21)18(20)13-12-16-8-4-2-5-9-16/h2-11,14H,12-13H2,1H3/b15-14+ |
| InChIKey | TWCIIXOJWKIKDQ-CCEZHUSRSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|