C11H10O4 — CID 54131380
2,3-dioxo-5-phenylpentanoic acid (PubChem CID 54131380) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,3-dioxo-5-phenylpentanoic acid.
| Compound Name | 2,3-dioxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 54131380 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2,3-dioxo-5-phenylpentanoic acid |
| SMILES | O=C(O)C(=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H10O4/c12-9(10(13)11(14)15)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15) |
| InChIKey | NUPQNLYUIHKQBC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|