About 4-fluoro-1,5-diphenylhex-4-en-3-one
4-fluoro-1,5-diphenylhex-4-en-3-one (PubChem CID 57365966) has the molecular formula C18H17FO
and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-fluoro-1,5-diphenylhex-4-en-3-one.
Molecular Properties
| Compound Name | 4-fluoro-1,5-diphenylhex-4-en-3-one |
| PubChem CID | 57365966 |
| Molecular Formula | C18H17FO |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-fluoro-1,5-diphenylhex-4-en-3-one |
| SMILES | CC(=C(F)C(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17FO/c1-14(16-10-6-3-7-11-16)18(19)17(20)13-12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3 |
| InChIKey | RTSNGGLMKRFJGO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,5-diphenylhex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,5-diphenylhex-4-en-3-one?
The IUPAC name of 4-fluoro-1,5-diphenylhex-4-en-3-one (CID 57365966) is 4-fluoro-1,5-diphenylhex-4-en-3-one.
What is the SMILES notation for 4-fluoro-1,5-diphenylhex-4-en-3-one?
The canonical SMILES for 4-fluoro-1,5-diphenylhex-4-en-3-one is CC(=C(F)C(=O)CCc1ccccc1)c1ccccc1.
What is the InChIKey of 4-fluoro-1,5-diphenylhex-4-en-3-one?
The InChIKey is RTSNGGLMKRFJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FO/c1-14(16-10-6-3-7-11-16)18(19)17(20)13-12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3.
What are the key properties of 4-fluoro-1,5-diphenylhex-4-en-3-one?
4-fluoro-1,5-diphenylhex-4-en-3-one has a molecular weight of 268.33 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,5-diphenylhex-4-en-3-one is sourced from PubChem (CID 57365966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).