C20H18Na2O4 — CID 66648612
disodium;(Z)-2,3-bis(2-phenylethyl)but-2-enedioate (PubChem CID 66648612) has the molecular formula C20H18Na2O4 and a molecular weight of 368.34 g/mol. Its IUPAC name is disodium;(Z)-2,3-bis(2-phenylethyl)but-2-enedioate.
| Compound Name | disodium;(Z)-2,3-bis(2-phenylethyl)but-2-enedioate |
|---|---|
| PubChem CID | 66648612 |
| Molecular Formula | C20H18Na2O4 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | disodium;(Z)-2,3-bis(2-phenylethyl)but-2-enedioate |
| SMILES | O=C([O-])/C(CCc1ccccc1)=C(/CCc1ccccc1)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H20O4.2Na/c21-19(22)17(13-11-15-7-3-1-4-8-15)18(20(23)24)14-12-16-9-5-2-6-10-16;;/h1-10H,11-14H2,(H,21,22)(H,23,24);;/q;2*+1/p-2/b18-17-;; |
| InChIKey | HBMDIIJPIZEGPY-NSGFTINJSA-L |
| XLogP | -4.94 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|