C31H35N2O3P — CID 87987500
[3-tert-butyl-1-cyano-2-oxo-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamic acid (PubChem CID 87987500) has the molecular formula C31H35N2O3P and a molecular weight of 514.61 g/mol. Its IUPAC name is [3-tert-butyl-1-cyano-2-oxo-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamic acid.
| Compound Name | [3-tert-butyl-1-cyano-2-oxo-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87987500 |
| Molecular Formula | C31H35N2O3P |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [3-tert-butyl-1-cyano-2-oxo-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamic acid |
| SMILES | CCCCC(NC(=O)O)(C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H35N2O3P/c1-5-6-22-31(30(2,3)4,33-29(35)36)28(34)27(23-32)37(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,33H,5-6,22H2,1-4H3,(H,35,36) |
| InChIKey | SEWGZNJDVHZNNX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|