C12H18O3P- — CID 18991839
2-hydroxyhexan-2-yl(phenyl)phosphinate (PubChem CID 18991839) has the molecular formula C12H18O3P- and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-hydroxyhexan-2-yl(phenyl)phosphinate.
| Compound Name | 2-hydroxyhexan-2-yl(phenyl)phosphinate |
|---|---|
| PubChem CID | 18991839 |
| Molecular Formula | C12H18O3P- |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-hydroxyhexan-2-yl(phenyl)phosphinate |
| SMILES | CCCCC(C)(O)P(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C12H19O3P/c1-3-4-10-12(2,13)16(14,15)11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | CUADINZKHQKRSP-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|