C42H45N4O4P — CID 90786220
butyl N-[(3R)-1-cyano-4,4-dimethyl-2-oxo-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamate (PubChem CID 90786220) has the molecular formula C42H45N4O4P and a molecular weight of 700.82 g/mol. Its IUPAC name is butyl N-[(3R)-1-cyano-4,4-dimethyl-2-oxo-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamate.
| Compound Name | butyl N-[(3R)-1-cyano-4,4-dimethyl-2-oxo-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 90786220 |
| Molecular Formula | C42H45N4O4P |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | butyl N-[(3R)-1-cyano-4,4-dimethyl-2-oxo-3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-1-(triphenyl-λ5-phosphanylidene)heptan-3-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@](Cc1nnc(-c2ccccc2)o1)(C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)CCC |
| InChI | InChI=1S/C42H45N4O4P/c1-5-7-29-49-40(48)44-42(41(3,4)28-6-2,30-37-45-46-39(50-37)32-20-12-8-13-21-32)38(47)36(31-43)51(33-22-14-9-15-23-33,34-24-16-10-17-25-34)35-26-18-11-19-27-35/h8-27H,5-7,28-30H2,1-4H3,(H,44,48)/t42-/m0/s1 |
| InChIKey | RNTVGUXIPGDIMK-WBCKFURZSA-N |
| XLogP | 7.63 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|